C18H18ClFN2 — CID 19368363
(E)-N-[(E)-(4-butyl-2-fluorophenyl)methylideneamino]-1-(4-chlorophenyl)methanimine (PubChem CID 19368363) has the molecular formula C18H18ClFN2 and a molecular weight of 316.81 g/mol. Its IUPAC name is (E)-N-[(E)-(4-butyl-2-fluorophenyl)methylideneamino]-1-(4-chlorophenyl)methanimine.
| Compound Name | (E)-N-[(E)-(4-butyl-2-fluorophenyl)methylideneamino]-1-(4-chlorophenyl)methanimine |
|---|---|
| PubChem CID | 19368363 |
| Molecular Formula | C18H18ClFN2 |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (E)-N-[(E)-(4-butyl-2-fluorophenyl)methylideneamino]-1-(4-chlorophenyl)methanimine |
| SMILES | CCCCc1ccc(/C=N/N=C/c2ccc(Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C18H18ClFN2/c1-2-3-4-14-5-8-16(18(20)11-14)13-22-21-12-15-6-9-17(19)10-7-15/h5-13H,2-4H2,1H3/b21-12+,22-13+ |
| InChIKey | AQXLASNEKNHXPQ-ADYPVIEZSA-N |
| XLogP | 5.27 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|