C19H20F2N2O — CID 19368243
(E)-1-(4-butylphenyl)-N-[(E)-(3,5-difluoro-4-methoxyphenyl)methylideneamino]methanimine (PubChem CID 19368243) has the molecular formula C19H20F2N2O and a molecular weight of 330.38 g/mol. Its IUPAC name is (E)-1-(4-butylphenyl)-N-[(E)-(3,5-difluoro-4-methoxyphenyl)methylideneamino]methanimine.
| Compound Name | (E)-1-(4-butylphenyl)-N-[(E)-(3,5-difluoro-4-methoxyphenyl)methylideneamino]methanimine |
|---|---|
| PubChem CID | 19368243 |
| Molecular Formula | C19H20F2N2O |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (E)-1-(4-butylphenyl)-N-[(E)-(3,5-difluoro-4-methoxyphenyl)methylideneamino]methanimine |
| SMILES | CCCCc1ccc(/C=N/N=C/c2cc(F)c(OC)c(F)c2)cc1 |
| InChI | InChI=1S/C19H20F2N2O/c1-3-4-5-14-6-8-15(9-7-14)12-22-23-13-16-10-17(20)19(24-2)18(21)11-16/h6-13H,3-5H2,1-2H3/b22-12+,23-13+ |
| InChIKey | MLXIKAJMAPMZRJ-FWSOMWAYSA-N |
| XLogP | 4.77 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|