C20H20F4N2O — CID 19368957
(E)-1-(4-butylphenyl)-N-[(E)-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]methanimine (PubChem CID 19368957) has the molecular formula C20H20F4N2O and a molecular weight of 380.39 g/mol. Its IUPAC name is (E)-1-(4-butylphenyl)-N-[(E)-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]methanimine.
| Compound Name | (E)-1-(4-butylphenyl)-N-[(E)-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]methanimine |
|---|---|
| PubChem CID | 19368957 |
| Molecular Formula | C20H20F4N2O |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (E)-1-(4-butylphenyl)-N-[(E)-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]methylideneamino]methanimine |
| SMILES | CCCCc1ccc(/C=N/N=C/c2ccc(OCC(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H20F4N2O/c1-2-3-4-15-5-7-16(8-6-15)12-25-26-13-17-9-10-19(18(21)11-17)27-14-20(22,23)24/h5-13H,2-4,14H2,1H3/b25-12+,26-13+ |
| InChIKey | UEWDKLCZXLICES-AAGZUKFUSA-N |
| XLogP | 5.56 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|