C21H25FN2 — CID 19368563
(E)-N-[(E)-(4-ethyl-3-fluorophenyl)methylideneamino]-1-(4-pentylphenyl)methanimine (PubChem CID 19368563) has the molecular formula C21H25FN2 and a molecular weight of 324.44 g/mol. Its IUPAC name is (E)-N-[(E)-(4-ethyl-3-fluorophenyl)methylideneamino]-1-(4-pentylphenyl)methanimine.
| Compound Name | (E)-N-[(E)-(4-ethyl-3-fluorophenyl)methylideneamino]-1-(4-pentylphenyl)methanimine |
|---|---|
| PubChem CID | 19368563 |
| Molecular Formula | C21H25FN2 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (E)-N-[(E)-(4-ethyl-3-fluorophenyl)methylideneamino]-1-(4-pentylphenyl)methanimine |
| SMILES | CCCCCc1ccc(/C=N/N=C/c2ccc(CC)c(F)c2)cc1 |
| InChI | InChI=1S/C21H25FN2/c1-3-5-6-7-17-8-10-18(11-9-17)15-23-24-16-19-12-13-20(4-2)21(22)14-19/h8-16H,3-7H2,1-2H3/b23-15+,24-16+ |
| InChIKey | GASFWVKNYYTPQO-DFEHQXHXSA-N |
| XLogP | 5.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|