C20H20F4N2O — CID 19368311
(E)-N-[(E)-[4-(difluoromethoxy)-3,5-difluorophenyl]methylideneamino]-1-(4-pentylphenyl)methanimine (PubChem CID 19368311) has the molecular formula C20H20F4N2O and a molecular weight of 380.39 g/mol. Its IUPAC name is (E)-N-[(E)-[4-(difluoromethoxy)-3,5-difluorophenyl]methylideneamino]-1-(4-pentylphenyl)methanimine.
| Compound Name | (E)-N-[(E)-[4-(difluoromethoxy)-3,5-difluorophenyl]methylideneamino]-1-(4-pentylphenyl)methanimine |
|---|---|
| PubChem CID | 19368311 |
| Molecular Formula | C20H20F4N2O |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (E)-N-[(E)-[4-(difluoromethoxy)-3,5-difluorophenyl]methylideneamino]-1-(4-pentylphenyl)methanimine |
| SMILES | CCCCCc1ccc(/C=N/N=C/c2cc(F)c(OC(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H20F4N2O/c1-2-3-4-5-14-6-8-15(9-7-14)12-25-26-13-16-10-17(21)19(18(22)11-16)27-20(23)24/h6-13,20H,2-5H2,1H3/b25-12+,26-13+ |
| InChIKey | CIVKKRQFZXPVBC-AAGZUKFUSA-N |
| XLogP | 5.75 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|