C16H12F4N2O2 — CID 19368279
(E)-N-[(E)-[4-(difluoromethoxy)-3,5-difluorophenyl]methylideneamino]-1-(4-methoxyphenyl)methanimine (PubChem CID 19368279) has the molecular formula C16H12F4N2O2 and a molecular weight of 340.28 g/mol. Its IUPAC name is (E)-N-[(E)-[4-(difluoromethoxy)-3,5-difluorophenyl]methylideneamino]-1-(4-methoxyphenyl)methanimine.
| Compound Name | (E)-N-[(E)-[4-(difluoromethoxy)-3,5-difluorophenyl]methylideneamino]-1-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 19368279 |
| Molecular Formula | C16H12F4N2O2 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | (E)-N-[(E)-[4-(difluoromethoxy)-3,5-difluorophenyl]methylideneamino]-1-(4-methoxyphenyl)methanimine |
| SMILES | COc1ccc(/C=N/N=C/c2cc(F)c(OC(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H12F4N2O2/c1-23-12-4-2-10(3-5-12)8-21-22-9-11-6-13(17)15(14(18)7-11)24-16(19)20/h2-9,16H,1H3/b21-8+,22-9+ |
| InChIKey | RMFVIAAZTXQJIF-QFNQXPJWSA-N |
| XLogP | 4.03 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|