C9H12N2O2 — CID 131871774
(3,5-dimethoxyphenyl)methylidenehydrazine (PubChem CID 131871774) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)methylidenehydrazine.
| Compound Name | (3,5-dimethoxyphenyl)methylidenehydrazine |
|---|---|
| PubChem CID | 131871774 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (3,5-dimethoxyphenyl)methylidenehydrazine |
| SMILES | COc1cc(C=NN)cc(OC)c1 |
| InChI | InChI=1S/C9H12N2O2/c1-12-8-3-7(6-11-10)4-9(5-8)13-2/h3-6H,10H2,1-2H3 |
| InChIKey | HNZRLCLPDYNOGD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|