C11H13ClFN5 — CID 118983766
1-N'-(3-chloro-4-fluorophenyl)-3-N'-methyl-2-methyliminopropanediimidamide (PubChem CID 118983766) has the molecular formula C11H13ClFN5 and a molecular weight of 269.71 g/mol. Its IUPAC name is 1-N'-(3-chloro-4-fluorophenyl)-3-N'-methyl-2-methyliminopropanediimidamide.
| Compound Name | 1-N'-(3-chloro-4-fluorophenyl)-3-N'-methyl-2-methyliminopropanediimidamide |
|---|---|
| PubChem CID | 118983766 |
| Molecular Formula | C11H13ClFN5 |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-N'-(3-chloro-4-fluorophenyl)-3-N'-methyl-2-methyliminopropanediimidamide |
| SMILES | C/N=C(N)/C(=N\C)C(/N)=N/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C11H13ClFN5/c1-16-9(10(14)17-2)11(15)18-6-3-4-8(13)7(12)5-6/h3-5H,1-2H3,(H2,14,17)(H2,15,18)/b16-9+ |
| InChIKey | XMKLLSLNAMYQMT-CXUHLZMHSA-N |
| XLogP | 1.53 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|