C13H15N5 — CID 118983741
1-N'-(3-ethynylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide (PubChem CID 118983741) has the molecular formula C13H15N5 and a molecular weight of 241.30 g/mol. Its IUPAC name is 1-N'-(3-ethynylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide.
| Compound Name | 1-N'-(3-ethynylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide |
|---|---|
| PubChem CID | 118983741 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-N'-(3-ethynylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide |
| SMILES | C#Cc1cccc(/N=C(N)/C(=N/C)C(/N)=N/C)c1 |
| InChI | InChI=1S/C13H15N5/c1-4-9-6-5-7-10(8-9)18-13(15)11(16-2)12(14)17-3/h1,5-8H,2-3H3,(H2,14,17)(H2,15,18)/b16-11+ |
| InChIKey | LLHPKRSDETZLSB-LFIBNONCSA-N |
| XLogP | 0.71 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|