C16H16BrClFN3OS2 — CID 142560569
S-[[2-[[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]sulfanylmethyl]phenyl]methyl] carbamothioate;hydrobromide (PubChem CID 142560569) has the molecular formula C16H16BrClFN3OS2 and a molecular weight of 464.81 g/mol. Its IUPAC name is S-[[2-[[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]sulfanylmethyl]phenyl]methyl] carbamothioate;hydrobromide.
| Compound Name | S-[[2-[[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]sulfanylmethyl]phenyl]methyl] carbamothioate;hydrobromide |
|---|---|
| PubChem CID | 142560569 |
| Molecular Formula | C16H16BrClFN3OS2 |
| Molecular Weight | 464.81 g/mol |
| Exact Mass | 462.96 |
| IUPAC Name | S-[[2-[[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]sulfanylmethyl]phenyl]methyl] carbamothioate;hydrobromide |
| SMILES | Br.NC(=O)SCc1ccccc1CS/C(N)=N/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H15ClFN3OS2.BrH/c17-13-7-12(5-6-14(13)18)21-15(19)23-8-10-3-1-2-4-11(10)9-24-16(20)22;/h1-7H,8-9H2,(H2,19,21)(H2,20,22);1H |
| InChIKey | AGJCEXHCWJGOAR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.81 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|