C22H19Br3ClN3OS — CID 142560594
[5-bromo-2-[(4-chlorophenyl)methylcarbamoyl]phenyl]methyl N'-(4-bromophenyl)carbamimidothioate;hydrobromide (PubChem CID 142560594) has the molecular formula C22H19Br3ClN3OS and a molecular weight of 648.65 g/mol. Its IUPAC name is [5-bromo-2-[(4-chlorophenyl)methylcarbamoyl]phenyl]methyl N'-(4-bromophenyl)carbamimidothioate;hydrobromide.
| Compound Name | [5-bromo-2-[(4-chlorophenyl)methylcarbamoyl]phenyl]methyl N'-(4-bromophenyl)carbamimidothioate;hydrobromide |
|---|---|
| PubChem CID | 142560594 |
| Molecular Formula | C22H19Br3ClN3OS |
| Molecular Weight | 648.65 g/mol |
| Exact Mass | 644.85 |
| IUPAC Name | [5-bromo-2-[(4-chlorophenyl)methylcarbamoyl]phenyl]methyl N'-(4-bromophenyl)carbamimidothioate;hydrobromide |
| SMILES | Br.N/C(=N\c1ccc(Br)cc1)SCc1cc(Br)ccc1C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18Br2ClN3OS.BrH/c23-16-3-8-19(9-4-16)28-22(26)30-13-15-11-17(24)5-10-20(15)21(29)27-12-14-1-6-18(25)7-2-14;/h1-11H,12-13H2,(H2,26,28)(H,27,29);1H |
| InChIKey | JPMDYCOVAPQVAR-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.65 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|