C17H15BrF3N3OS — CID 138574578
[5-bromo-2-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl carbamimidothioate (PubChem CID 138574578) has the molecular formula C17H15BrF3N3OS and a molecular weight of 446.29 g/mol. Its IUPAC name is [5-bromo-2-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl carbamimidothioate.
| Compound Name | [5-bromo-2-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 138574578 |
| Molecular Formula | C17H15BrF3N3OS |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | [5-bromo-2-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1cc(Br)ccc1C(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15BrF3N3OS/c18-13-5-6-14(11(7-13)9-26-16(22)23)15(25)24-8-10-1-3-12(4-2-10)17(19,20)21/h1-7H,8-9H2,(H3,22,23)(H,24,25) |
| InChIKey | XLOGGCVTMHKXGB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|