C18H19BrClFN2OS — CID 159573340
[2-(2-oxobutyl)phenyl]methyl N'-(3-chloro-4-fluorophenyl)carbamimidothioate;hydrobromide (PubChem CID 159573340) has the molecular formula C18H19BrClFN2OS and a molecular weight of 445.79 g/mol. Its IUPAC name is [2-(2-oxobutyl)phenyl]methyl N'-(3-chloro-4-fluorophenyl)carbamimidothioate;hydrobromide.
| Compound Name | [2-(2-oxobutyl)phenyl]methyl N'-(3-chloro-4-fluorophenyl)carbamimidothioate;hydrobromide |
|---|---|
| PubChem CID | 159573340 |
| Molecular Formula | C18H19BrClFN2OS |
| Molecular Weight | 445.79 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | [2-(2-oxobutyl)phenyl]methyl N'-(3-chloro-4-fluorophenyl)carbamimidothioate;hydrobromide |
| SMILES | Br.CCC(=O)Cc1ccccc1CS/C(N)=N/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H18ClFN2OS.BrH/c1-2-15(23)9-12-5-3-4-6-13(12)11-24-18(21)22-14-7-8-17(20)16(19)10-14;/h3-8,10H,2,9,11H2,1H3,(H2,21,22);1H |
| InChIKey | PGXHUZLSKAVLIM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.79 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|