C15H14ClN7 — CID 168602636
2-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168602636) has the molecular formula C15H14ClN7 and a molecular weight of 327.78 g/mol. Its IUPAC name is 2-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168602636 |
| Molecular Formula | C15H14ClN7 |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccc(Cl)c(-c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C15H14ClN7/c16-10-6-5-8(20-15(19)23-14(17)18)7-9(10)13-21-11-3-1-2-4-12(11)22-13/h1-7H,(H,21,22)(H6,17,18,19,20,23) |
| InChIKey | KMIALRJTKXVCSH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|