C15H13ClN4 — CID 169365402
N'-[2-(1H-benzimidazol-2-yl)phenyl]-2-chloroethanimidamide (PubChem CID 169365402) has the molecular formula C15H13ClN4 and a molecular weight of 284.75 g/mol. Its IUPAC name is N'-[2-(1H-benzimidazol-2-yl)phenyl]-2-chloroethanimidamide.
| Compound Name | N'-[2-(1H-benzimidazol-2-yl)phenyl]-2-chloroethanimidamide |
|---|---|
| PubChem CID | 169365402 |
| Molecular Formula | C15H13ClN4 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N'-[2-(1H-benzimidazol-2-yl)phenyl]-2-chloroethanimidamide |
| SMILES | N/C(CCl)=N/c1ccccc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H13ClN4/c16-9-14(17)18-11-6-2-1-5-10(11)15-19-12-7-3-4-8-13(12)20-15/h1-8H,9H2,(H2,17,18)(H,19,20) |
| InChIKey | KOBJEBLVNPYQCM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|