C18H16N4 — CID 121287803
(1Z,3E)-5-[2-(1H-benzimidazol-2-yl)phenyl]iminopenta-1,3-dien-1-amine (PubChem CID 121287803) has the molecular formula C18H16N4 and a molecular weight of 288.35 g/mol. Its IUPAC name is (1Z,3E)-5-[2-(1H-benzimidazol-2-yl)phenyl]iminopenta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-5-[2-(1H-benzimidazol-2-yl)phenyl]iminopenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 121287803 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (1Z,3E)-5-[2-(1H-benzimidazol-2-yl)phenyl]iminopenta-1,3-dien-1-amine |
| SMILES | N/C=C\C=C\C=N\c1ccccc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H16N4/c19-12-6-1-7-13-20-15-9-3-2-8-14(15)18-21-16-10-4-5-11-17(16)22-18/h1-13H,19H2,(H,21,22)/b7-1+,12-6-,20-13+ |
| InChIKey | VBXGVKWAXHDELB-YRBSRSGLSA-N |
| XLogP | 3.96 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|