C27H29N3O — CID 3110761
4-[2-(1H-benzimidazol-2-yl)phenyl]imino-2,6-ditert-butylcyclohexa-2,5-dien-1-one (PubChem CID 3110761) has the molecular formula C27H29N3O and a molecular weight of 411.55 g/mol. Its IUPAC name is 4-[2-(1H-benzimidazol-2-yl)phenyl]imino-2,6-ditert-butylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-[2-(1H-benzimidazol-2-yl)phenyl]imino-2,6-ditert-butylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 3110761 |
| Molecular Formula | C27H29N3O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 4-[2-(1H-benzimidazol-2-yl)phenyl]imino-2,6-ditert-butylcyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=Nc2ccccc2-c2nc3ccccc3[nH]2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C27H29N3O/c1-26(2,3)19-15-17(16-20(24(19)31)27(4,5)6)28-21-12-8-7-11-18(21)25-29-22-13-9-10-14-23(22)30-25/h7-16H,1-6H3,(H,29,30) |
| InChIKey | KEZPDAVVGVYFHV-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|