C32H32N8O4S2 — CID 139084043
N'-[2-(1H-benzimidazol-2-yl)phenyl]sulfonyl-N,N-dimethylmethanimidamide (PubChem CID 139084043) has the molecular formula C32H32N8O4S2 and a molecular weight of 656.79 g/mol. Its IUPAC name is N'-[2-(1H-benzimidazol-2-yl)phenyl]sulfonyl-N,N-dimethylmethanimidamide.
| Compound Name | N'-[2-(1H-benzimidazol-2-yl)phenyl]sulfonyl-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 139084043 |
| Molecular Formula | C32H32N8O4S2 |
| Molecular Weight | 656.79 g/mol |
| Exact Mass | 656.20 |
| IUPAC Name | N'-[2-(1H-benzimidazol-2-yl)phenyl]sulfonyl-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/S(=O)(=O)c1ccccc1-c1nc2ccccc2[nH]1.CN(C)/C=N/S(=O)(=O)c1ccccc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/2C16H16N4O2S/c2*1-20(2)11-17-23(21,22)15-10-6-3-7-12(15)16-18-13-8-4-5-9-14(13)19-16/h2*3-11H,1-2H3,(H,18,19)/b2*17-11+ |
| InChIKey | JIRYCBNHHNAUKH-IPUHMNBYSA-N |
| XLogP | 5.02 |
| TPSA | 156.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.79 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|