About prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate
prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate (PubChem CID 91673725) has the molecular formula C17H10Cl2N2O2
and a molecular weight of 345.19 g/mol. Its IUPAC name is prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate |
| PubChem CID | 91673725 |
| Molecular Formula | C17H10Cl2N2O2 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate |
| SMILES | C#CCOC(=O)c1ccc2nc(-c3ccc(Cl)c(Cl)c3)[nH]c2c1 |
| InChI | InChI=1S/C17H10Cl2N2O2/c1-2-7-23-17(22)11-4-6-14-15(9-11)21-16(20-14)10-3-5-12(18)13(19)8-10/h1,3-6,8-9H,7H2,(H,20,21) |
| InChIKey | LZHIFJHNHIBUKK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate?
The IUPAC name of prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate (CID 91673725) is prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate.
What is the SMILES notation for prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate?
The canonical SMILES for prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate is C#CCOC(=O)c1ccc2nc(-c3ccc(Cl)c(Cl)c3)[nH]c2c1.
What is the InChIKey of prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate?
The InChIKey is LZHIFJHNHIBUKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10Cl2N2O2/c1-2-7-23-17(22)11-4-6-14-15(9-11)21-16(20-14)10-3-5-12(18)13(19)8-10/h1,3-6,8-9H,7H2,(H,20,21).
What are the key properties of prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate?
prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate has a molecular weight of 345.19 g/mol, XLogP of 4.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate is sourced from PubChem (CID 91673725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).