C23H18ClN3O3 — CID 23915819
[2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-phenyl-3H-benzimidazole-5-carboxylate (PubChem CID 23915819) has the molecular formula C23H18ClN3O3 and a molecular weight of 419.87 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-phenyl-3H-benzimidazole-5-carboxylate.
| Compound Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-phenyl-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 23915819 |
| Molecular Formula | C23H18ClN3O3 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-phenyl-3H-benzimidazole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2nc(-c3ccccc3)[nH]c2c1)NCc1ccccc1Cl |
| InChI | InChI=1S/C23H18ClN3O3/c24-18-9-5-4-8-17(18)13-25-21(28)14-30-23(29)16-10-11-19-20(12-16)27-22(26-19)15-6-2-1-3-7-15/h1-12H,13-14H2,(H,25,28)(H,26,27) |
| InChIKey | QDTFVZUVGKTFHJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |