C14H11N5O3 — CID 91902909
2-(4-nitrophenyl)-3H-benzimidazole-5-carbohydrazide (PubChem CID 91902909) has the molecular formula C14H11N5O3 and a molecular weight of 297.27 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-3H-benzimidazole-5-carbohydrazide.
| Compound Name | 2-(4-nitrophenyl)-3H-benzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 91902909 |
| Molecular Formula | C14H11N5O3 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-(4-nitrophenyl)-3H-benzimidazole-5-carbohydrazide |
| SMILES | NNC(=O)c1ccc2nc(-c3ccc([N+](=O)[O-])cc3)[nH]c2c1 |
| InChI | InChI=1S/C14H11N5O3/c15-18-14(20)9-3-6-11-12(7-9)17-13(16-11)8-1-4-10(5-2-8)19(21)22/h1-7H,15H2,(H,16,17)(H,18,20) |
| InChIKey | LAFZVLYFBAMBON-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|