C17H13N5O3 — CID 67743452
N-(2-cyanoethyl)-2-(3-nitrophenyl)-3H-benzimidazole-5-carboxamide (PubChem CID 67743452) has the molecular formula C17H13N5O3 and a molecular weight of 335.32 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(3-nitrophenyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(2-cyanoethyl)-2-(3-nitrophenyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67743452 |
| Molecular Formula | C17H13N5O3 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-(2-cyanoethyl)-2-(3-nitrophenyl)-3H-benzimidazole-5-carboxamide |
| SMILES | N#CCCNC(=O)c1ccc2nc(-c3cccc([N+](=O)[O-])c3)[nH]c2c1 |
| InChI | InChI=1S/C17H13N5O3/c18-7-2-8-19-17(23)12-5-6-14-15(10-12)21-16(20-14)11-3-1-4-13(9-11)22(24)25/h1,3-6,9-10H,2,8H2,(H,19,23)(H,20,21) |
| InChIKey | DQSDZUSYBULUFX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|