C20H13ClN4O3 — CID 69347834
2-chloro-N-[2-(3-nitrophenyl)-3H-benzimidazol-5-yl]benzamide (PubChem CID 69347834) has the molecular formula C20H13ClN4O3 and a molecular weight of 392.80 g/mol. Its IUPAC name is 2-chloro-N-[2-(3-nitrophenyl)-3H-benzimidazol-5-yl]benzamide.
| Compound Name | 2-chloro-N-[2-(3-nitrophenyl)-3H-benzimidazol-5-yl]benzamide |
|---|---|
| PubChem CID | 69347834 |
| Molecular Formula | C20H13ClN4O3 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 2-chloro-N-[2-(3-nitrophenyl)-3H-benzimidazol-5-yl]benzamide |
| SMILES | O=C(Nc1ccc2nc(-c3cccc([N+](=O)[O-])c3)[nH]c2c1)c1ccccc1Cl |
| InChI | InChI=1S/C20H13ClN4O3/c21-16-7-2-1-6-15(16)20(26)22-13-8-9-17-18(11-13)24-19(23-17)12-4-3-5-14(10-12)25(27)28/h1-11H,(H,22,26)(H,23,24) |
| InChIKey | LDNIMZUCXHHCPD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|