C23H19FN4O6 — CID 55901767
N-[2-(3-fluorophenyl)-3H-benzimidazol-5-yl]-3,4,5-trimethoxy-2-nitrobenzamide (PubChem CID 55901767) has the molecular formula C23H19FN4O6 and a molecular weight of 466.43 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-3H-benzimidazol-5-yl]-3,4,5-trimethoxy-2-nitrobenzamide.
| Compound Name | N-[2-(3-fluorophenyl)-3H-benzimidazol-5-yl]-3,4,5-trimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55901767 |
| Molecular Formula | C23H19FN4O6 |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | N-[2-(3-fluorophenyl)-3H-benzimidazol-5-yl]-3,4,5-trimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc3nc(-c4cccc(F)c4)[nH]c3c2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C23H19FN4O6/c1-32-18-11-15(19(28(30)31)21(34-3)20(18)33-2)23(29)25-14-7-8-16-17(10-14)27-22(26-16)12-5-4-6-13(24)9-12/h4-11H,1-3H3,(H,25,29)(H,26,27) |
| InChIKey | KLQPNFZGPKYXOH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|