C23H19FN4O5 — CID 55729564
5-ethoxy-N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]-4-methoxy-2-nitrobenzamide (PubChem CID 55729564) has the molecular formula C23H19FN4O5 and a molecular weight of 450.43 g/mol. Its IUPAC name is 5-ethoxy-N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]-4-methoxy-2-nitrobenzamide.
| Compound Name | 5-ethoxy-N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]-4-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55729564 |
| Molecular Formula | C23H19FN4O5 |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 5-ethoxy-N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]-4-methoxy-2-nitrobenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc3nc(-c4ccc(F)cc4)[nH]c3c2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H19FN4O5/c1-3-33-21-11-16(19(28(30)31)12-20(21)32-2)23(29)25-15-8-9-17-18(10-15)27-22(26-17)13-4-6-14(24)7-5-13/h4-12H,3H2,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | XMSFZPALWJWTCI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|