C14H13N5 — CID 153286644
2-(3-methyl-2-pyridinyl)-3H-benzimidazole-5-carboximidamide (PubChem CID 153286644) has the molecular formula C14H13N5 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-(3-methyl-2-pyridinyl)-3H-benzimidazole-5-carboximidamide.
| Compound Name | 2-(3-methyl-2-pyridinyl)-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 153286644 |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-(3-methyl-2-pyridinyl)-3H-benzimidazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2nc(-c3ncccc3C)[nH]c2c1 |
| InChI | InChI=1S/C14H13N5/c1-8-3-2-6-17-12(8)14-18-10-5-4-9(13(15)16)7-11(10)19-14/h2-7H,1H3,(H3,15,16)(H,18,19) |
| InChIKey | RQYWZKYLNBAELO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|