C20H18Cl2N8Se — CID 146014497
2-[5-(6-carbamimidoyl-1H-benzimidazol-2-yl)selenophen-2-yl]-3H-benzimidazole-5-carboximidamide;dihydrochloride (PubChem CID 146014497) has the molecular formula C20H18Cl2N8Se and a molecular weight of 520.29 g/mol. Its IUPAC name is 2-[5-(6-carbamimidoyl-1H-benzimidazol-2-yl)selenophen-2-yl]-3H-benzimidazole-5-carboximidamide;dihydrochloride.
| Compound Name | 2-[5-(6-carbamimidoyl-1H-benzimidazol-2-yl)selenophen-2-yl]-3H-benzimidazole-5-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 146014497 |
| Molecular Formula | C20H18Cl2N8Se |
| Molecular Weight | 520.29 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | 2-[5-(6-carbamimidoyl-1H-benzimidazol-2-yl)selenophen-2-yl]-3H-benzimidazole-5-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc2nc(-c3ccc(-c4nc5ccc(/C(N)=N/[H])cc5[nH]4)[se]3)[nH]c2c1 |
| InChI | InChI=1S/C20H16N8Se.2ClH/c21-17(22)9-1-3-11-13(7-9)27-19(25-11)15-5-6-16(29-15)20-26-12-4-2-10(18(23)24)8-14(12)28-20;;/h1-8H,(H3,21,22)(H3,23,24)(H,25,27)(H,26,28);2*1H |
| InChIKey | ZXDJCXGSFWTRMS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|