C13H12N6S — CID 137314301
2-(5-carbamimidoylthiophen-2-yl)-3H-benzimidazole-5-carboximidamide (PubChem CID 137314301) has the molecular formula C13H12N6S and a molecular weight of 284.35 g/mol. Its IUPAC name is 2-(5-carbamimidoylthiophen-2-yl)-3H-benzimidazole-5-carboximidamide.
| Compound Name | 2-(5-carbamimidoylthiophen-2-yl)-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 137314301 |
| Molecular Formula | C13H12N6S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-(5-carbamimidoylthiophen-2-yl)-3H-benzimidazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2nc(-c3ccc(/C(N)=N/[H])s3)[nH]c2c1 |
| InChI | InChI=1S/C13H12N6S/c14-11(15)6-1-2-7-8(5-6)19-13(18-7)10-4-3-9(20-10)12(16)17/h1-5H,(H3,14,15)(H3,16,17)(H,18,19) |
| InChIKey | QNUQCBZJCZGOAX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|