C17H18N6O2 — CID 22125539
2-(6-carbamimidoyl-1H-benzimidazol-2-yl)-N-(2-methoxyethyl)pyridine-3-carboxamide (PubChem CID 22125539) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-(6-carbamimidoyl-1H-benzimidazol-2-yl)-N-(2-methoxyethyl)pyridine-3-carboxamide.
| Compound Name | 2-(6-carbamimidoyl-1H-benzimidazol-2-yl)-N-(2-methoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22125539 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-(6-carbamimidoyl-1H-benzimidazol-2-yl)-N-(2-methoxyethyl)pyridine-3-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc2nc(-c3ncccc3C(=O)NCCOC)[nH]c2c1 |
| InChI | InChI=1S/C17H18N6O2/c1-25-8-7-21-17(24)11-3-2-6-20-14(11)16-22-12-5-4-10(15(18)19)9-13(12)23-16/h2-6,9H,7-8H2,1H3,(H3,18,19)(H,21,24)(H,22,23) |
| InChIKey | WABSLHMKUWIVCR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|