C17H20N6O2 — CID 57200800
ethyl 4-[2-(6-carbamimidoyl-1H-benzimidazol-2-yl)imidazol-1-yl]butanoate (PubChem CID 57200800) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is ethyl 4-[2-(6-carbamimidoyl-1H-benzimidazol-2-yl)imidazol-1-yl]butanoate.
| Compound Name | ethyl 4-[2-(6-carbamimidoyl-1H-benzimidazol-2-yl)imidazol-1-yl]butanoate |
|---|---|
| PubChem CID | 57200800 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | ethyl 4-[2-(6-carbamimidoyl-1H-benzimidazol-2-yl)imidazol-1-yl]butanoate |
| SMILES | [H]/N=C(\N)c1ccc2nc(-c3nccn3CCCC(=O)OCC)[nH]c2c1 |
| InChI | InChI=1S/C17H20N6O2/c1-2-25-14(24)4-3-8-23-9-7-20-17(23)16-21-12-6-5-11(15(18)19)10-13(12)22-16/h5-7,9-10H,2-4,8H2,1H3,(H3,18,19)(H,21,22) |
| InChIKey | CWTYDHYULZLYTH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|