C26H24N6O3 — CID 57189223
2-(6-carbamimidoyl-1H-benzimidazol-2-yl)-N-[2-(1,3-dioxol-4-yl)-3-phenylpropyl]pyridine-3-carboxamide (PubChem CID 57189223) has the molecular formula C26H24N6O3 and a molecular weight of 468.52 g/mol. Its IUPAC name is 2-(6-carbamimidoyl-1H-benzimidazol-2-yl)-N-[2-(1,3-dioxol-4-yl)-3-phenylpropyl]pyridine-3-carboxamide.
| Compound Name | 2-(6-carbamimidoyl-1H-benzimidazol-2-yl)-N-[2-(1,3-dioxol-4-yl)-3-phenylpropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 57189223 |
| Molecular Formula | C26H24N6O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 2-(6-carbamimidoyl-1H-benzimidazol-2-yl)-N-[2-(1,3-dioxol-4-yl)-3-phenylpropyl]pyridine-3-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc2nc(-c3ncccc3C(=O)NCC(Cc3ccccc3)C3=COCO3)[nH]c2c1 |
| InChI | InChI=1S/C26H24N6O3/c27-24(28)17-8-9-20-21(12-17)32-25(31-20)23-19(7-4-10-29-23)26(33)30-13-18(22-14-34-15-35-22)11-16-5-2-1-3-6-16/h1-10,12,14,18H,11,13,15H2,(H3,27,28)(H,30,33)(H,31,32) |
| InChIKey | AIEZZFGYADWTNH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|