C15H21N3O2 — CID 142258214
tert-butyl N-[(2-ethyl-3H-benzimidazol-5-yl)methyl]carbamate (PubChem CID 142258214) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is tert-butyl N-[(2-ethyl-3H-benzimidazol-5-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(2-ethyl-3H-benzimidazol-5-yl)methyl]carbamate |
|---|---|
| PubChem CID | 142258214 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | tert-butyl N-[(2-ethyl-3H-benzimidazol-5-yl)methyl]carbamate |
| SMILES | CCc1nc2ccc(CNC(=O)OC(C)(C)C)cc2[nH]1 |
| InChI | InChI=1S/C15H21N3O2/c1-5-13-17-11-7-6-10(8-12(11)18-13)9-16-14(19)20-15(2,3)4/h6-8H,5,9H2,1-4H3,(H,16,19)(H,17,18) |
| InChIKey | DELDNTJHNIPPFV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |