C20H20F3N3O2 — CID 59487175
tert-butyl N-[[3-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]phenyl]methyl]carbamate (PubChem CID 59487175) has the molecular formula C20H20F3N3O2 and a molecular weight of 391.39 g/mol. Its IUPAC name is tert-butyl N-[[3-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59487175 |
| Molecular Formula | C20H20F3N3O2 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | tert-butyl N-[[3-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(-c2nc3ccc(C(F)(F)F)cc3[nH]2)c1 |
| InChI | InChI=1S/C20H20F3N3O2/c1-19(2,3)28-18(27)24-11-12-5-4-6-13(9-12)17-25-15-8-7-14(20(21,22)23)10-16(15)26-17/h4-10H,11H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | QPNRFEAZUVOMCG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |