C18H16F3N3O3 — CID 121471468
[2-(4-methoxyphenyl)-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]carbamic acid (PubChem CID 121471468) has the molecular formula C18H16F3N3O3 and a molecular weight of 379.34 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]carbamic acid.
| Compound Name | [2-(4-methoxyphenyl)-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 121471468 |
| Molecular Formula | C18H16F3N3O3 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | [2-(4-methoxyphenyl)-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]carbamic acid |
| SMILES | COc1ccc(CC(NC(=O)O)c2nc3ccc(C(F)(F)F)cc3[nH]2)cc1 |
| InChI | InChI=1S/C18H16F3N3O3/c1-27-12-5-2-10(3-6-12)8-15(24-17(25)26)16-22-13-7-4-11(18(19,20)21)9-14(13)23-16/h2-7,9,15,24H,8H2,1H3,(H,22,23)(H,25,26) |
| InChIKey | HPRYJNOMJGEVLB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |