C26H28N4O2 — CID 121471284
1-[1-(1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]-3-[2-(4-methylphenyl)ethyl]urea (PubChem CID 121471284) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-[1-(1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]-3-[2-(4-methylphenyl)ethyl]urea.
| Compound Name | 1-[1-(1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]-3-[2-(4-methylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 121471284 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-[1-(1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]-3-[2-(4-methylphenyl)ethyl]urea |
| SMILES | COc1ccc(CC(NC(=O)NCCc2ccc(C)cc2)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C26H28N4O2/c1-18-7-9-19(10-8-18)15-16-27-26(31)30-24(17-20-11-13-21(32-2)14-12-20)25-28-22-5-3-4-6-23(22)29-25/h3-14,24H,15-17H2,1-2H3,(H,28,29)(H2,27,30,31) |
| InChIKey | LPMKBSGBQIQVRQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |