C21H25N5O2 — CID 121471144
1-[(1R)-1-(1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]-3-pyrrolidin-3-ylurea (PubChem CID 121471144) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[(1R)-1-(1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]-3-pyrrolidin-3-ylurea.
| Compound Name | 1-[(1R)-1-(1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]-3-pyrrolidin-3-ylurea |
|---|---|
| PubChem CID | 121471144 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-[(1R)-1-(1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]-3-pyrrolidin-3-ylurea |
| SMILES | COc1ccc(C[C@@H](NC(=O)NC2CCNC2)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C21H25N5O2/c1-28-16-8-6-14(7-9-16)12-19(26-21(27)23-15-10-11-22-13-15)20-24-17-4-2-3-5-18(17)25-20/h2-9,15,19,22H,10-13H2,1H3,(H,24,25)(H2,23,26,27)/t15?,19-/m1/s1 |
| InChIKey | ILWPBFKMESTZGA-XCWJXAQQSA-N |
| XLogP | 2.52 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |