C23H28N4O3 — CID 121471237
1-[1-(1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]-3-(3-hydroxycyclohexyl)urea (PubChem CID 121471237) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-[1-(1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]-3-(3-hydroxycyclohexyl)urea.
| Compound Name | 1-[1-(1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]-3-(3-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 121471237 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1-[1-(1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]-3-(3-hydroxycyclohexyl)urea |
| SMILES | COc1ccc(CC(NC(=O)NC2CCCC(O)C2)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C23H28N4O3/c1-30-18-11-9-15(10-12-18)13-21(22-25-19-7-2-3-8-20(19)26-22)27-23(29)24-16-5-4-6-17(28)14-16/h2-3,7-12,16-17,21,28H,4-6,13-14H2,1H3,(H,25,26)(H2,24,27,29) |
| InChIKey | OQKRZGYIJXXNRU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |