C17H15F2N3O3 — CID 121471348
[1-(6-fluoro-1H-benzimidazol-2-yl)-2-(3-fluoro-4-methoxyphenyl)ethyl]carbamic acid (PubChem CID 121471348) has the molecular formula C17H15F2N3O3 and a molecular weight of 347.32 g/mol. Its IUPAC name is [1-(6-fluoro-1H-benzimidazol-2-yl)-2-(3-fluoro-4-methoxyphenyl)ethyl]carbamic acid.
| Compound Name | [1-(6-fluoro-1H-benzimidazol-2-yl)-2-(3-fluoro-4-methoxyphenyl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 121471348 |
| Molecular Formula | C17H15F2N3O3 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | [1-(6-fluoro-1H-benzimidazol-2-yl)-2-(3-fluoro-4-methoxyphenyl)ethyl]carbamic acid |
| SMILES | COc1ccc(CC(NC(=O)O)c2nc3ccc(F)cc3[nH]2)cc1F |
| InChI | InChI=1S/C17H15F2N3O3/c1-25-15-5-2-9(6-11(15)19)7-14(22-17(23)24)16-20-12-4-3-10(18)8-13(12)21-16/h2-6,8,14,22H,7H2,1H3,(H,20,21)(H,23,24) |
| InChIKey | JFCUEFONWSDYOA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |