C27H29N3O3 — CID 77225957
tert-butyl N-[1-(1H-benzimidazol-2-yl)-2-(4-phenylmethoxyphenyl)ethyl]carbamate (PubChem CID 77225957) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is tert-butyl N-[1-(1H-benzimidazol-2-yl)-2-(4-phenylmethoxyphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(1H-benzimidazol-2-yl)-2-(4-phenylmethoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 77225957 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | tert-butyl N-[1-(1H-benzimidazol-2-yl)-2-(4-phenylmethoxyphenyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(OCc2ccccc2)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C27H29N3O3/c1-27(2,3)33-26(31)30-24(25-28-22-11-7-8-12-23(22)29-25)17-19-13-15-21(16-14-19)32-18-20-9-5-4-6-10-20/h4-16,24H,17-18H2,1-3H3,(H,28,29)(H,30,31) |
| InChIKey | YYVXXABLMLOPED-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |