C23H36BN3O4 — CID 70831176
tert-butyl N-propan-2-yl-N-[(1S)-1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]ethyl]carbamate (PubChem CID 70831176) has the molecular formula C23H36BN3O4 and a molecular weight of 429.37 g/mol. Its IUPAC name is tert-butyl N-propan-2-yl-N-[(1S)-1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-propan-2-yl-N-[(1S)-1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 70831176 |
| Molecular Formula | C23H36BN3O4 |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | tert-butyl N-propan-2-yl-N-[(1S)-1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]ethyl]carbamate |
| SMILES | CC(C)N(C(=O)OC(C)(C)C)[C@@H](C)c1nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2[nH]1 |
| InChI | InChI=1S/C23H36BN3O4/c1-14(2)27(20(28)29-21(4,5)6)15(3)19-25-17-12-11-16(13-18(17)26-19)24-30-22(7,8)23(9,10)31-24/h11-15H,1-10H3,(H,25,26)/t15-/m0/s1 |
| InChIKey | HSTWLBUAJXVRCU-HNNXBMFYSA-N |
| XLogP | 4.57 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|