C32H45BN2O6 — CID 160590711
benzyl (2S,6S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate (PubChem CID 160590711) has the molecular formula C32H45BN2O6 and a molecular weight of 564.53 g/mol. Its IUPAC name is benzyl (2S,6S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | benzyl (2S,6S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 160590711 |
| Molecular Formula | C32H45BN2O6 |
| Molecular Weight | 564.53 g/mol |
| Exact Mass | 564.34 |
| IUPAC Name | benzyl (2S,6S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NCC[C@@H]1CCC[C@@H](c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H45BN2O6/c1-30(2,3)39-28(36)34-21-20-26-14-11-15-27(35(26)29(37)38-22-23-12-9-8-10-13-23)24-16-18-25(19-17-24)33-40-31(4,5)32(6,7)41-33/h8-10,12-13,16-19,26-27H,11,14-15,20-22H2,1-7H3,(H,34,36)/t26-,27-/m0/s1 |
| InChIKey | RVUUZCIDWUUFTR-SVBPBHIXSA-N |
| XLogP | 6.13 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.53 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|