C22H33BN2O4 — CID 59745634
tert-butyl 2,4,5,7-tetramethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-c]pyridine-1-carboxylate (PubChem CID 59745634) has the molecular formula C22H33BN2O4 and a molecular weight of 400.33 g/mol. Its IUPAC name is tert-butyl 2,4,5,7-tetramethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-c]pyridine-1-carboxylate.
| Compound Name | tert-butyl 2,4,5,7-tetramethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 59745634 |
| Molecular Formula | C22H33BN2O4 |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | tert-butyl 2,4,5,7-tetramethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-c]pyridine-1-carboxylate |
| SMILES | Cc1nc(C)c2c(c1C)c(B1OC(C)(C)C(C)(C)O1)c(C)n2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33BN2O4/c1-12-13(2)24-14(3)18-16(12)17(23-28-21(8,9)22(10,11)29-23)15(4)25(18)19(26)27-20(5,6)7/h1-11H3 |
| InChIKey | DVHWKCJPTOHAMP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|