C38H52BBrN6O12 — CID 162071282
ditert-butyl 6-bromo-2-oxoimidazo[4,5-b]pyridine-1,3-dicarboxylate;ditert-butyl 2-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[4,5-b]pyridine-1,3-dicarboxylate (PubChem CID 162071282) has the molecular formula C38H52BBrN6O12 and a molecular weight of 875.58 g/mol. Its IUPAC name is ditert-butyl 6-bromo-2-oxoimidazo[4,5-b]pyridine-1,3-dicarboxylate;ditert-butyl 2-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[4,5-b]pyridine-1,3-dicarboxylate.
| Compound Name | ditert-butyl 6-bromo-2-oxoimidazo[4,5-b]pyridine-1,3-dicarboxylate;ditert-butyl 2-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[4,5-b]pyridine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 162071282 |
| Molecular Formula | C38H52BBrN6O12 |
| Molecular Weight | 875.58 g/mol |
| Exact Mass | 874.29 |
| IUPAC Name | ditert-butyl 6-bromo-2-oxoimidazo[4,5-b]pyridine-1,3-dicarboxylate;ditert-butyl 2-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[4,5-b]pyridine-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(=O)n(C(=O)OC(C)(C)C)c2ncc(B3OC(C)(C)C(C)(C)O3)cc21.CC(C)(C)OC(=O)n1c(=O)n(C(=O)OC(C)(C)C)c2ncc(Br)cc21 |
| InChI | InChI=1S/C22H32BN3O7.C16H20BrN3O5/c1-19(2,3)30-17(28)25-14-11-13(23-32-21(7,8)22(9,10)33-23)12-24-15(14)26(16(25)27)18(29)31-20(4,5)6;1-15(2,3)24-13(22)19-10-7-9(17)8-18-11(10)20(12(19)21)14(23)25-16(4,5)6/h11-12H,1-10H3;7-8H,1-6H3 |
| InChIKey | ZBCQTBWYFBUFHK-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 203.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.58 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|