C18H24BBrN2O4 — CID 164886180
tert-butyl 6-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[3,2-b]pyridine-1-carboxylate (PubChem CID 164886180) has the molecular formula C18H24BBrN2O4 and a molecular weight of 423.12 g/mol. Its IUPAC name is tert-butyl 6-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[3,2-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[3,2-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 164886180 |
| Molecular Formula | C18H24BBrN2O4 |
| Molecular Weight | 423.12 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | tert-butyl 6-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[3,2-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(B2OC(C)(C)C(C)(C)O2)cc2ncc(Br)cc21 |
| InChI | InChI=1S/C18H24BBrN2O4/c1-16(2,3)24-15(23)22-13-8-11(20)10-21-12(13)9-14(22)19-25-17(4,5)18(6,7)26-19/h8-10H,1-7H3 |
| InChIKey | FLCXAYNUPDYDMM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.12 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|