C23H22BNO3 — CID 171613082
18-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-14-oxa-12-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),2,4,6,8(13),9,11,16,18-nonaene (PubChem CID 171613082) has the molecular formula C23H22BNO3 and a molecular weight of 371.25 g/mol. Its IUPAC name is 18-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-14-oxa-12-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),2,4,6,8(13),9,11,16,18-nonaene.
| Compound Name | 18-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-14-oxa-12-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),2,4,6,8(13),9,11,16,18-nonaene |
|---|---|
| PubChem CID | 171613082 |
| Molecular Formula | C23H22BNO3 |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 18-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-14-oxa-12-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),2,4,6,8(13),9,11,16,18-nonaene |
| SMILES | CC1(C)OB(c2ccc3c(c2)-c2ccccc2-c2cccnc2O3)OC1(C)C |
| InChI | InChI=1S/C23H22BNO3/c1-22(2)23(3,4)28-24(27-22)15-11-12-20-19(14-15)17-9-6-5-8-16(17)18-10-7-13-25-21(18)26-20/h5-14H,1-4H3 |
| InChIKey | DSDMYYQPJUHWPF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|