C21H26BFN2O5 — CID 174069068
2-[3-(1,3-dioxolan-2-ylmethyl)-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-methylpyrimidine (PubChem CID 174069068) has the molecular formula C21H26BFN2O5 and a molecular weight of 416.26 g/mol. Its IUPAC name is 2-[3-(1,3-dioxolan-2-ylmethyl)-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-methylpyrimidine.
| Compound Name | 2-[3-(1,3-dioxolan-2-ylmethyl)-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-methylpyrimidine |
|---|---|
| PubChem CID | 174069068 |
| Molecular Formula | C21H26BFN2O5 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 2-[3-(1,3-dioxolan-2-ylmethyl)-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-methylpyrimidine |
| SMILES | Cc1ccnc(Oc2ccc(B3OC(C)(C)C(C)(C)O3)c(CC3OCCO3)c2F)n1 |
| InChI | InChI=1S/C21H26BFN2O5/c1-13-8-9-24-19(25-13)28-16-7-6-15(22-29-20(2,3)21(4,5)30-22)14(18(16)23)12-17-26-10-11-27-17/h6-9,17H,10-12H2,1-5H3 |
| InChIKey | HJAVVNHNNITAPG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|