C17H17BF4N2O3 — CID 140761254
2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-(trifluoromethyl)pyrimidine (PubChem CID 140761254) has the molecular formula C17H17BF4N2O3 and a molecular weight of 384.14 g/mol. Its IUPAC name is 2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-(trifluoromethyl)pyrimidine.
| Compound Name | 2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 140761254 |
| Molecular Formula | C17H17BF4N2O3 |
| Molecular Weight | 384.14 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-4-(trifluoromethyl)pyrimidine |
| SMILES | CC1(C)OB(c2ccc(Oc3nccc(C(F)(F)F)n3)cc2F)OC1(C)C |
| InChI | InChI=1S/C17H17BF4N2O3/c1-15(2)16(3,4)27-18(26-15)11-6-5-10(9-12(11)19)25-14-23-8-7-13(24-14)17(20,21)22/h5-9H,1-4H3 |
| InChIKey | LNJVDRYVXGOEBJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.14 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|