C22H24BFN2O6 — CID 67440028
6-[3-(1,3-dioxolan-2-yl)-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-methoxypyridine-3-carbonitrile (PubChem CID 67440028) has the molecular formula C22H24BFN2O6 and a molecular weight of 442.25 g/mol. Its IUPAC name is 6-[3-(1,3-dioxolan-2-yl)-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-methoxypyridine-3-carbonitrile.
| Compound Name | 6-[3-(1,3-dioxolan-2-yl)-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-methoxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 67440028 |
| Molecular Formula | C22H24BFN2O6 |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 6-[3-(1,3-dioxolan-2-yl)-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-methoxypyridine-3-carbonitrile |
| SMILES | COc1nc(Oc2ccc(B3OC(C)(C)C(C)(C)O3)c(C3OCCO3)c2F)ccc1C#N |
| InChI | InChI=1S/C22H24BFN2O6/c1-21(2)22(3,4)32-23(31-21)14-7-8-15(18(24)17(14)20-28-10-11-29-20)30-16-9-6-13(12-25)19(26-16)27-5/h6-9,20H,10-11H2,1-5H3 |
| InChIKey | HKEHENTXCCUDIW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 92.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|