C16H14BBr5O6 — CID 157293715
2-bromo-4,6-dihydroxybenzaldehyde;2-bromo-4,6-dimethoxybenzaldehyde;tribromoborane (PubChem CID 157293715) has the molecular formula C16H14BBr5O6 and a molecular weight of 712.61 g/mol. Its IUPAC name is 2-bromo-4,6-dihydroxybenzaldehyde;2-bromo-4,6-dimethoxybenzaldehyde;tribromoborane.
| Compound Name | 2-bromo-4,6-dihydroxybenzaldehyde;2-bromo-4,6-dimethoxybenzaldehyde;tribromoborane |
|---|---|
| PubChem CID | 157293715 |
| Molecular Formula | C16H14BBr5O6 |
| Molecular Weight | 712.61 g/mol |
| Exact Mass | 707.68 |
| IUPAC Name | 2-bromo-4,6-dihydroxybenzaldehyde;2-bromo-4,6-dimethoxybenzaldehyde;tribromoborane |
| SMILES | BrB(Br)Br.COc1cc(Br)c(C=O)c(OC)c1.O=Cc1c(O)cc(O)cc1Br |
| InChI | InChI=1S/C9H9BrO3.C7H5BrO3.BBr3/c1-12-6-3-8(10)7(5-11)9(4-6)13-2;8-6-1-4(10)2-7(11)5(6)3-9;2-1(3)4/h3-5H,1-2H3;1-3,10-11H; |
| InChIKey | BBCCFXQPKIGVIJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|