C19H26BN3O4S — CID 168618008
N-[[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168618008) has the molecular formula C19H26BN3O4S and a molecular weight of 403.31 g/mol. Its IUPAC name is N-[[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168618008 |
| Molecular Formula | C19H26BN3O4S |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | COc1cc(OC)c(C=NNc2nc(C)cs2)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C19H26BN3O4S/c1-12-11-28-17(22-12)23-21-10-14-15(8-13(24-6)9-16(14)25-7)20-26-18(2,3)19(4,5)27-20/h8-11H,1-7H3,(H,22,23) |
| InChIKey | SMBZUXODNGUUMR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|